C10H23N3O3 — CID 175839028
(2S)-2-amino-3-methylbutanamide;(2S)-2-amino-3-methylbutanoic acid (PubChem CID 175839028) has the molecular formula C10H23N3O3 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanamide;(2S)-2-amino-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-methylbutanamide;(2S)-2-amino-3-methylbutanoic acid |
|---|---|
| PubChem CID | 175839028 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | (2S)-2-amino-3-methylbutanamide;(2S)-2-amino-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)O.CC(C)[C@H](N)C(N)=O |
| InChI | InChI=1S/C5H12N2O.C5H11NO2/c2*1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H2,7,8);3-4H,6H2,1-2H3,(H,7,8)/t2*4-/m00/s1 |
| InChIKey | WTFLBPWKXQVBPE-RZVRUWJTSA-N |
| XLogP | -0.49 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |