About magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride
magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride (PubChem CID 159678853) has the molecular formula C5H11Cl2MgNO2
and a molecular weight of 212.36 g/mol. Its IUPAC name is magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride.
Molecular Properties
| Compound Name | magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride |
| PubChem CID | 159678853 |
| Molecular Formula | C5H11Cl2MgNO2 |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride |
| SMILES | CC(C)[C@H](N)C(=O)O.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C5H11NO2.2ClH.Mg/c1-3(2)4(6)5(7)8;;;/h3-4H,6H2,1-2H3,(H,7,8);2*1H;/q;;;+2/p-2/t4-;;;/m0.../s1 |
| InChIKey | MUYNNKBJRDPFMP-WJXVXWFNSA-L |
| XLogP | -6.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | -6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride?
The IUPAC name of magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride (CID 159678853) is magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride.
What is the SMILES notation for magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride?
The canonical SMILES for magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride is CC(C)[C@H](N)C(=O)O.[Cl-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride?
The InChIKey is MUYNNKBJRDPFMP-WJXVXWFNSA-L. The full InChI is InChI=1S/C5H11NO2.2ClH.Mg/c1-3(2)4(6)5(7)8;;;/h3-4H,6H2,1-2H3,(H,7,8);2*1H;/q;;;+2/p-2/t4-;;;/m0.../s1.
What are the key properties of magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride?
magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride has a molecular weight of 212.36 g/mol, XLogP of -6.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(2S)-2-amino-3-methylbutanoic acid;dichloride is sourced from PubChem (CID 159678853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).