About (2S)-2-amino-3-methylbutanoic acid;silyloxysilane
(2S)-2-amino-3-methylbutanoic acid;silyloxysilane (PubChem CID 173116914) has the molecular formula C5H17NO3Si2
and a molecular weight of 195.37 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;silyloxysilane.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;silyloxysilane |
| PubChem CID | 173116914 |
| Molecular Formula | C5H17NO3Si2 |
| Molecular Weight | 195.37 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;silyloxysilane |
| SMILES | CC(C)[C@H](N)C(=O)O.[SiH3]O[SiH3] |
| InChI | InChI=1S/C5H11NO2.H6OSi2/c1-3(2)4(6)5(7)8;2-1-3/h3-4H,6H2,1-2H3,(H,7,8);2-3H3/t4-;/m0./s1 |
| InChIKey | FOCHUEACVIXIAW-WCCKRBBISA-N |
| XLogP | -2.38 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.37 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-methylbutanoic acid;silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutanoic acid;silyloxysilane?
The IUPAC name of (2S)-2-amino-3-methylbutanoic acid;silyloxysilane (CID 173116914) is (2S)-2-amino-3-methylbutanoic acid;silyloxysilane.
What is the SMILES notation for (2S)-2-amino-3-methylbutanoic acid;silyloxysilane?
The canonical SMILES for (2S)-2-amino-3-methylbutanoic acid;silyloxysilane is CC(C)[C@H](N)C(=O)O.[SiH3]O[SiH3].
What is the InChIKey of (2S)-2-amino-3-methylbutanoic acid;silyloxysilane?
The InChIKey is FOCHUEACVIXIAW-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2.H6OSi2/c1-3(2)4(6)5(7)8;2-1-3/h3-4H,6H2,1-2H3,(H,7,8);2-3H3/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-3-methylbutanoic acid;silyloxysilane?
(2S)-2-amino-3-methylbutanoic acid;silyloxysilane has a molecular weight of 195.37 g/mol, XLogP of -2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutanoic acid;silyloxysilane is sourced from PubChem (CID 173116914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).