About bis((2S)-2-amino-3-methylbutanoic acid);sulfane
bis((2S)-2-amino-3-methylbutanoic acid);sulfane (PubChem CID 87598201) has the molecular formula C10H24N2O4S
and a molecular weight of 268.38 g/mol. Its IUPAC name is bis((2S)-2-amino-3-methylbutanoic acid);sulfane.
Molecular Properties
| Compound Name | bis((2S)-2-amino-3-methylbutanoic acid);sulfane |
| PubChem CID | 87598201 |
| Molecular Formula | C10H24N2O4S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | bis((2S)-2-amino-3-methylbutanoic acid);sulfane |
| SMILES | CC(C)[C@H](N)C(=O)O.CC(C)[C@H](N)C(=O)O.S |
| InChI | InChI=1S/2C5H11NO2.H2S/c2*1-3(2)4(6)5(7)8;/h2*3-4H,6H2,1-2H3,(H,7,8);1H2/t2*4-;/m00./s1 |
| InChIKey | WLEIFWUFJNAGGV-SCGRZTRASA-N |
| XLogP | 0.22 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis((2S)-2-amino-3-methylbutanoic acid);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-2-amino-3-methylbutanoic acid);sulfane?
The IUPAC name of bis((2S)-2-amino-3-methylbutanoic acid);sulfane (CID 87598201) is bis((2S)-2-amino-3-methylbutanoic acid);sulfane.
What is the SMILES notation for bis((2S)-2-amino-3-methylbutanoic acid);sulfane?
The canonical SMILES for bis((2S)-2-amino-3-methylbutanoic acid);sulfane is CC(C)[C@H](N)C(=O)O.CC(C)[C@H](N)C(=O)O.S.
What is the InChIKey of bis((2S)-2-amino-3-methylbutanoic acid);sulfane?
The InChIKey is WLEIFWUFJNAGGV-SCGRZTRASA-N. The full InChI is InChI=1S/2C5H11NO2.H2S/c2*1-3(2)4(6)5(7)8;/h2*3-4H,6H2,1-2H3,(H,7,8);1H2/t2*4-;/m00./s1.
What are the key properties of bis((2S)-2-amino-3-methylbutanoic acid);sulfane?
bis((2S)-2-amino-3-methylbutanoic acid);sulfane has a molecular weight of 268.38 g/mol, XLogP of 0.22, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-2-amino-3-methylbutanoic acid);sulfane is sourced from PubChem (CID 87598201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).