About 2-methylpropanamide;bis(propan-2-one)
2-methylpropanamide;bis(propan-2-one) (PubChem CID 174404145) has the molecular formula C10H21NO3
and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-methylpropanamide;bis(propan-2-one).
Molecular Properties
| Compound Name | 2-methylpropanamide;bis(propan-2-one) |
| PubChem CID | 174404145 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-methylpropanamide;bis(propan-2-one) |
| SMILES | CC(C)=O.CC(C)=O.CC(C)C(N)=O |
| InChI | InChI=1S/C4H9NO.2C3H6O/c1-3(2)4(5)6;2*1-3(2)4/h3H,1-2H3,(H2,5,6);2*1-2H3 |
| InChIKey | UFVKSARUFKZMBM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropanamide;bis(propan-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanamide;bis(propan-2-one)?
The IUPAC name of 2-methylpropanamide;bis(propan-2-one) (CID 174404145) is 2-methylpropanamide;bis(propan-2-one).
What is the SMILES notation for 2-methylpropanamide;bis(propan-2-one)?
The canonical SMILES for 2-methylpropanamide;bis(propan-2-one) is CC(C)=O.CC(C)=O.CC(C)C(N)=O.
What is the InChIKey of 2-methylpropanamide;bis(propan-2-one)?
The InChIKey is UFVKSARUFKZMBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.2C3H6O/c1-3(2)4(5)6;2*1-3(2)4/h3H,1-2H3,(H2,5,6);2*1-2H3.
What are the key properties of 2-methylpropanamide;bis(propan-2-one)?
2-methylpropanamide;bis(propan-2-one) has a molecular weight of 203.28 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;bis(propan-2-one) is sourced from PubChem (CID 174404145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).