About 2-methylpropanamide;pyrrolidine
2-methylpropanamide;pyrrolidine (PubChem CID 174809960) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 2-methylpropanamide;pyrrolidine.
Molecular Properties
| Compound Name | 2-methylpropanamide;pyrrolidine |
| PubChem CID | 174809960 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-methylpropanamide;pyrrolidine |
| SMILES | C1CCNC1.CC(C)C(N)=O |
| InChI | InChI=1S/C4H9NO.C4H9N/c1-3(2)4(5)6;1-2-4-5-3-1/h3H,1-2H3,(H2,5,6);5H,1-4H2 |
| InChIKey | HRPXXLGFBSBHMI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropanamide;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanamide;pyrrolidine?
The IUPAC name of 2-methylpropanamide;pyrrolidine (CID 174809960) is 2-methylpropanamide;pyrrolidine.
What is the SMILES notation for 2-methylpropanamide;pyrrolidine?
The canonical SMILES for 2-methylpropanamide;pyrrolidine is C1CCNC1.CC(C)C(N)=O.
What is the InChIKey of 2-methylpropanamide;pyrrolidine?
The InChIKey is HRPXXLGFBSBHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H9N/c1-3(2)4(5)6;1-2-4-5-3-1/h3H,1-2H3,(H2,5,6);5H,1-4H2.
What are the key properties of 2-methylpropanamide;pyrrolidine?
2-methylpropanamide;pyrrolidine has a molecular weight of 158.25 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;pyrrolidine is sourced from PubChem (CID 174809960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).