About ethane;2-methylpropanamide;molecular hydrogen
ethane;2-methylpropanamide;molecular hydrogen (PubChem CID 143394269) has the molecular formula C6H17NO
and a molecular weight of 119.21 g/mol. Its IUPAC name is ethane;2-methylpropanamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-methylpropanamide;molecular hydrogen |
| PubChem CID | 143394269 |
| Molecular Formula | C6H17NO |
| Molecular Weight | 119.21 g/mol |
| Exact Mass | 119.13 |
| IUPAC Name | ethane;2-methylpropanamide;molecular hydrogen |
| SMILES | CC.CC(C)C(N)=O.[H][H] |
| InChI | InChI=1S/C4H9NO.C2H6.H2/c1-3(2)4(5)6;1-2;/h3H,1-2H3,(H2,5,6);1-2H3;1H |
| InChIKey | YPSCEFPMEHDUCF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methylpropanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropanamide;molecular hydrogen?
The IUPAC name of ethane;2-methylpropanamide;molecular hydrogen (CID 143394269) is ethane;2-methylpropanamide;molecular hydrogen.
What is the SMILES notation for ethane;2-methylpropanamide;molecular hydrogen?
The canonical SMILES for ethane;2-methylpropanamide;molecular hydrogen is CC.CC(C)C(N)=O.[H][H].
What is the InChIKey of ethane;2-methylpropanamide;molecular hydrogen?
The InChIKey is YPSCEFPMEHDUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C2H6.H2/c1-3(2)4(5)6;1-2;/h3H,1-2H3,(H2,5,6);1-2H3;1H.
What are the key properties of ethane;2-methylpropanamide;molecular hydrogen?
ethane;2-methylpropanamide;molecular hydrogen has a molecular weight of 119.21 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropanamide;molecular hydrogen is sourced from PubChem (CID 143394269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).