About butan-1-ol;ethane;2-methylpropanamide
butan-1-ol;ethane;2-methylpropanamide (PubChem CID 142541326) has the molecular formula C10H25NO2
and a molecular weight of 191.31 g/mol. Its IUPAC name is butan-1-ol;ethane;2-methylpropanamide.
Molecular Properties
| Compound Name | butan-1-ol;ethane;2-methylpropanamide |
| PubChem CID | 142541326 |
| Molecular Formula | C10H25NO2 |
| Molecular Weight | 191.31 g/mol |
| Exact Mass | 191.19 |
| IUPAC Name | butan-1-ol;ethane;2-methylpropanamide |
| SMILES | CC.CC(C)C(N)=O.CCCCO |
| InChI | InChI=1S/C4H9NO.C4H10O.C2H6/c1-3(2)4(5)6;1-2-3-4-5;1-2/h3H,1-2H3,(H2,5,6);5H,2-4H2,1H3;1-2H3 |
| InChIKey | KPGXLLSLUFCBGO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-1-ol;ethane;2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;ethane;2-methylpropanamide?
The IUPAC name of butan-1-ol;ethane;2-methylpropanamide (CID 142541326) is butan-1-ol;ethane;2-methylpropanamide.
What is the SMILES notation for butan-1-ol;ethane;2-methylpropanamide?
The canonical SMILES for butan-1-ol;ethane;2-methylpropanamide is CC.CC(C)C(N)=O.CCCCO.
What is the InChIKey of butan-1-ol;ethane;2-methylpropanamide?
The InChIKey is KPGXLLSLUFCBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H10O.C2H6/c1-3(2)4(5)6;1-2-3-4-5;1-2/h3H,1-2H3,(H2,5,6);5H,2-4H2,1H3;1-2H3.
What are the key properties of butan-1-ol;ethane;2-methylpropanamide?
butan-1-ol;ethane;2-methylpropanamide has a molecular weight of 191.31 g/mol, XLogP of 1.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;ethane;2-methylpropanamide is sourced from PubChem (CID 142541326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).