About 2-chloroacetyl chloride;2-methylpropanamide
2-chloroacetyl chloride;2-methylpropanamide (PubChem CID 174918876) has the molecular formula C6H11Cl2NO2
and a molecular weight of 200.06 g/mol. Its IUPAC name is 2-chloroacetyl chloride;2-methylpropanamide.
Molecular Properties
| Compound Name | 2-chloroacetyl chloride;2-methylpropanamide |
| PubChem CID | 174918876 |
| Molecular Formula | C6H11Cl2NO2 |
| Molecular Weight | 200.06 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 2-chloroacetyl chloride;2-methylpropanamide |
| SMILES | CC(C)C(N)=O.O=C(Cl)CCl |
| InChI | InChI=1S/C4H9NO.C2H2Cl2O/c1-3(2)4(5)6;3-1-2(4)5/h3H,1-2H3,(H2,5,6);1H2 |
| InChIKey | QWZIBXJRJJIPKN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.06 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetyl chloride;2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetyl chloride;2-methylpropanamide?
The IUPAC name of 2-chloroacetyl chloride;2-methylpropanamide (CID 174918876) is 2-chloroacetyl chloride;2-methylpropanamide.
What is the SMILES notation for 2-chloroacetyl chloride;2-methylpropanamide?
The canonical SMILES for 2-chloroacetyl chloride;2-methylpropanamide is CC(C)C(N)=O.O=C(Cl)CCl.
What is the InChIKey of 2-chloroacetyl chloride;2-methylpropanamide?
The InChIKey is QWZIBXJRJJIPKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C2H2Cl2O/c1-3(2)4(5)6;3-1-2(4)5/h3H,1-2H3,(H2,5,6);1H2.
What are the key properties of 2-chloroacetyl chloride;2-methylpropanamide?
2-chloroacetyl chloride;2-methylpropanamide has a molecular weight of 200.06 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetyl chloride;2-methylpropanamide is sourced from PubChem (CID 174918876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).