About acetyl bromide;2-chloroacetyl chloride
acetyl bromide;2-chloroacetyl chloride (PubChem CID 88646573) has the molecular formula C4H5BrCl2O2
and a molecular weight of 235.89 g/mol. Its IUPAC name is acetyl bromide;2-chloroacetyl chloride.
Molecular Properties
| Compound Name | acetyl bromide;2-chloroacetyl chloride |
| PubChem CID | 88646573 |
| Molecular Formula | C4H5BrCl2O2 |
| Molecular Weight | 235.89 g/mol |
| Exact Mass | 233.88 |
| IUPAC Name | acetyl bromide;2-chloroacetyl chloride |
| SMILES | CC(=O)Br.O=C(Cl)CCl |
| InChI | InChI=1S/C2H3BrO.C2H2Cl2O/c1-2(3)4;3-1-2(4)5/h1H3;1H2 |
| InChIKey | MEVKERPKWWFWOP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.89 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetyl bromide;2-chloroacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl bromide;2-chloroacetyl chloride?
The IUPAC name of acetyl bromide;2-chloroacetyl chloride (CID 88646573) is acetyl bromide;2-chloroacetyl chloride.
What is the SMILES notation for acetyl bromide;2-chloroacetyl chloride?
The canonical SMILES for acetyl bromide;2-chloroacetyl chloride is CC(=O)Br.O=C(Cl)CCl.
What is the InChIKey of acetyl bromide;2-chloroacetyl chloride?
The InChIKey is MEVKERPKWWFWOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrO.C2H2Cl2O/c1-2(3)4;3-1-2(4)5/h1H3;1H2.
What are the key properties of acetyl bromide;2-chloroacetyl chloride?
acetyl bromide;2-chloroacetyl chloride has a molecular weight of 235.89 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl bromide;2-chloroacetyl chloride is sourced from PubChem (CID 88646573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).