C8H16FeN2O6 — CID 175941555
bis((2S,3R)-2-amino-3-hydroxybutanoate);iron(2+) (PubChem CID 175941555) has the molecular formula C8H16FeN2O6 and a molecular weight of 292.07 g/mol. Its IUPAC name is bis((2S,3R)-2-amino-3-hydroxybutanoate);iron(2+).
| Compound Name | bis((2S,3R)-2-amino-3-hydroxybutanoate);iron(2+) |
|---|---|
| PubChem CID | 175941555 |
| Molecular Formula | C8H16FeN2O6 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | bis((2S,3R)-2-amino-3-hydroxybutanoate);iron(2+) |
| SMILES | C[C@@H](O)[C@H](N)C(=O)[O-].C[C@@H](O)[C@H](N)C(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C4H9NO3.Fe/c2*1-2(6)3(5)4(7)8;/h2*2-3,6H,5H2,1H3,(H,7,8);/q;;+2/p-2/t2*2-,3+;/m11./s1 |
| InChIKey | YFEQTTKCJYFVPU-PZXRSRGQSA-L |
| XLogP | -5.11 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|