About (2S)-2-aminopropanoate
(2S)-2-aminopropanoate (PubChem CID 5460980) has the molecular formula C3H6NO2-
and a molecular weight of 88.09 g/mol. Its IUPAC name is (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoate |
| PubChem CID | 5460980 |
| Molecular Formula | C3H6NO2- |
| Molecular Weight | 88.09 g/mol |
| Exact Mass | 88.04 |
| IUPAC Name | (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/p-1/t2-/m0/s1 |
| InChIKey | QNAYBMKLOCPYGJ-REOHCLBHSA-M |
| XLogP | -1.92 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.09 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoate?
The IUPAC name of (2S)-2-aminopropanoate (CID 5460980) is (2S)-2-aminopropanoate.
What is the SMILES notation for (2S)-2-aminopropanoate?
The canonical SMILES for (2S)-2-aminopropanoate is C[C@H](N)C(=O)[O-].
What is the InChIKey of (2S)-2-aminopropanoate?
The InChIKey is QNAYBMKLOCPYGJ-REOHCLBHSA-M. The full InChI is InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/p-1/t2-/m0/s1.
What are the key properties of (2S)-2-aminopropanoate?
(2S)-2-aminopropanoate has a molecular weight of 88.09 g/mol, XLogP of -1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoate is sourced from PubChem (CID 5460980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).