About 2-aminopropanoate;hydron;hydrochloride
2-aminopropanoate;hydron;hydrochloride (PubChem CID 173141944) has the molecular formula C3H8ClNO2
and a molecular weight of 125.55 g/mol. Its IUPAC name is 2-aminopropanoate;hydron;hydrochloride.
Molecular Properties
| Compound Name | 2-aminopropanoate;hydron;hydrochloride |
| PubChem CID | 173141944 |
| Molecular Formula | C3H8ClNO2 |
| Molecular Weight | 125.55 g/mol |
| Exact Mass | 125.02 |
| IUPAC Name | 2-aminopropanoate;hydron;hydrochloride |
| SMILES | CC(N)C(=O)[O-].Cl.[H+] |
| InChI | InChI=1S/C3H7NO2.ClH/c1-2(4)3(5)6;/h2H,4H2,1H3,(H,5,6);1H |
| InChIKey | ILYVXUGGBVATGA-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.55 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopropanoate;hydron;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoate;hydron;hydrochloride?
The IUPAC name of 2-aminopropanoate;hydron;hydrochloride (CID 173141944) is 2-aminopropanoate;hydron;hydrochloride.
What is the SMILES notation for 2-aminopropanoate;hydron;hydrochloride?
The canonical SMILES for 2-aminopropanoate;hydron;hydrochloride is CC(N)C(=O)[O-].Cl.[H+].
What is the InChIKey of 2-aminopropanoate;hydron;hydrochloride?
The InChIKey is ILYVXUGGBVATGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.ClH/c1-2(4)3(5)6;/h2H,4H2,1H3,(H,5,6);1H.
What are the key properties of 2-aminopropanoate;hydron;hydrochloride?
2-aminopropanoate;hydron;hydrochloride has a molecular weight of 125.55 g/mol, XLogP of -1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoate;hydron;hydrochloride is sourced from PubChem (CID 173141944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).