About potassium 2-aminopropanoate
potassium 2-aminopropanoate (PubChem CID 21339510) has the molecular formula C3H6KNO2
and a molecular weight of 127.18 g/mol. Its IUPAC name is potassium 2-aminopropanoate.
Molecular Properties
| Compound Name | potassium 2-aminopropanoate |
| PubChem CID | 21339510 |
| Molecular Formula | C3H6KNO2 |
| Molecular Weight | 127.18 g/mol |
| Exact Mass | 127.00 |
| IUPAC Name | potassium 2-aminopropanoate |
| SMILES | CC(N)C(=O)[O-].[K+] |
| InChI | InChI=1S/C3H7NO2.K/c1-2(4)3(5)6;/h2H,4H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | UJLZCNZPJMYEKF-UHFFFAOYSA-M |
| XLogP | -4.91 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.18 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-aminopropanoate?
The IUPAC name of potassium 2-aminopropanoate (CID 21339510) is potassium 2-aminopropanoate.
What is the SMILES notation for potassium 2-aminopropanoate?
The canonical SMILES for potassium 2-aminopropanoate is CC(N)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-aminopropanoate?
The InChIKey is UJLZCNZPJMYEKF-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO2.K/c1-2(4)3(5)6;/h2H,4H2,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of potassium 2-aminopropanoate?
potassium 2-aminopropanoate has a molecular weight of 127.18 g/mol, XLogP of -4.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-aminopropanoate is sourced from PubChem (CID 21339510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).