About calcium bis(2-methylpropanoate)
calcium bis(2-methylpropanoate) (PubChem CID 102602609) has the molecular formula C8H14CaO4
and a molecular weight of 214.27 g/mol. Its IUPAC name is calcium bis(2-methylpropanoate).
Molecular Properties
| Compound Name | calcium bis(2-methylpropanoate) |
| PubChem CID | 102602609 |
| Molecular Formula | C8H14CaO4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | calcium bis(2-methylpropanoate) |
| SMILES | CC(C)C(=O)[O-].CC(C)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C4H8O2.Ca/c2*1-3(2)4(5)6;/h2*3H,1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | BVTQVYBMHFSYPL-UHFFFAOYSA-L |
| XLogP | -1.60 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium bis(2-methylpropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(2-methylpropanoate)?
The IUPAC name of calcium bis(2-methylpropanoate) (CID 102602609) is calcium bis(2-methylpropanoate).
What is the SMILES notation for calcium bis(2-methylpropanoate)?
The canonical SMILES for calcium bis(2-methylpropanoate) is CC(C)C(=O)[O-].CC(C)C(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(2-methylpropanoate)?
The InChIKey is BVTQVYBMHFSYPL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O2.Ca/c2*1-3(2)4(5)6;/h2*3H,1-2H3,(H,5,6);/q;;+2/p-2.
What are the key properties of calcium bis(2-methylpropanoate)?
calcium bis(2-methylpropanoate) has a molecular weight of 214.27 g/mol, XLogP of -1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(2-methylpropanoate) is sourced from PubChem (CID 102602609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).