About calcium;2-hydroxypropanoate;trihydrate
calcium;2-hydroxypropanoate;trihydrate (PubChem CID 23621454) has the molecular formula C3H11CaO6+
and a molecular weight of 183.19 g/mol. Its IUPAC name is calcium;2-hydroxypropanoate;trihydrate.
Molecular Properties
| Compound Name | calcium;2-hydroxypropanoate;trihydrate |
| PubChem CID | 23621454 |
| Molecular Formula | C3H11CaO6+ |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | calcium;2-hydroxypropanoate;trihydrate |
| SMILES | CC(O)C(=O)[O-].O.O.O.[Ca+2] |
| InChI | InChI=1S/C3H6O3.Ca.3H2O/c1-2(4)3(5)6;;;;/h2,4H,1H3,(H,5,6);;3*1H2/q;+2;;;/p-1 |
| InChIKey | JLDMICKSGKMFLG-UHFFFAOYSA-M |
| XLogP | -4.74 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;2-hydroxypropanoate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-hydroxypropanoate;trihydrate?
The IUPAC name of calcium;2-hydroxypropanoate;trihydrate (CID 23621454) is calcium;2-hydroxypropanoate;trihydrate.
What is the SMILES notation for calcium;2-hydroxypropanoate;trihydrate?
The canonical SMILES for calcium;2-hydroxypropanoate;trihydrate is CC(O)C(=O)[O-].O.O.O.[Ca+2].
What is the InChIKey of calcium;2-hydroxypropanoate;trihydrate?
The InChIKey is JLDMICKSGKMFLG-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.Ca.3H2O/c1-2(4)3(5)6;;;;/h2,4H,1H3,(H,5,6);;3*1H2/q;+2;;;/p-1.
What are the key properties of calcium;2-hydroxypropanoate;trihydrate?
calcium;2-hydroxypropanoate;trihydrate has a molecular weight of 183.19 g/mol, XLogP of -4.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-hydroxypropanoate;trihydrate is sourced from PubChem (CID 23621454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).