About dicalcium;2-hydroxypropanoate;carbonate
dicalcium;2-hydroxypropanoate;carbonate (PubChem CID 19973760) has the molecular formula C4H5Ca2O6+
and a molecular weight of 229.23 g/mol. Its IUPAC name is dicalcium;2-hydroxypropanoate;carbonate.
Molecular Properties
| Compound Name | dicalcium;2-hydroxypropanoate;carbonate |
| PubChem CID | 19973760 |
| Molecular Formula | C4H5Ca2O6+ |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 228.93 |
| IUPAC Name | dicalcium;2-hydroxypropanoate;carbonate |
| SMILES | CC(O)C(=O)[O-].O=C([O-])[O-].[Ca+2].[Ca+2] |
| InChI | InChI=1S/C3H6O3.CH2O3.2Ca/c1-2(4)3(5)6;2-1(3)4;;/h2,4H,1H3,(H,5,6);(H2,2,3,4);;/q;;2*+2/p-3 |
| InChIKey | VJIJJHQISSHRNM-UHFFFAOYSA-K |
| XLogP | -5.09 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dicalcium;2-hydroxypropanoate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;2-hydroxypropanoate;carbonate?
The IUPAC name of dicalcium;2-hydroxypropanoate;carbonate (CID 19973760) is dicalcium;2-hydroxypropanoate;carbonate.
What is the SMILES notation for dicalcium;2-hydroxypropanoate;carbonate?
The canonical SMILES for dicalcium;2-hydroxypropanoate;carbonate is CC(O)C(=O)[O-].O=C([O-])[O-].[Ca+2].[Ca+2].
What is the InChIKey of dicalcium;2-hydroxypropanoate;carbonate?
The InChIKey is VJIJJHQISSHRNM-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H6O3.CH2O3.2Ca/c1-2(4)3(5)6;2-1(3)4;;/h2,4H,1H3,(H,5,6);(H2,2,3,4);;/q;;2*+2/p-3.
What are the key properties of dicalcium;2-hydroxypropanoate;carbonate?
dicalcium;2-hydroxypropanoate;carbonate has a molecular weight of 229.23 g/mol, XLogP of -5.09, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;2-hydroxypropanoate;carbonate is sourced from PubChem (CID 19973760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).