About calcium bis(2-iodopropanoate)
calcium bis(2-iodopropanoate) (PubChem CID 88606274) has the molecular formula C6H8CaI2O4
and a molecular weight of 438.01 g/mol. Its IUPAC name is calcium bis(2-iodopropanoate).
Molecular Properties
| Compound Name | calcium bis(2-iodopropanoate) |
| PubChem CID | 88606274 |
| Molecular Formula | C6H8CaI2O4 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.81 |
| IUPAC Name | calcium bis(2-iodopropanoate) |
| SMILES | CC(I)C(=O)[O-].CC(I)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C3H5IO2.Ca/c2*1-2(4)3(5)6;/h2*2H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | ZKFDHVMOPYPGMX-UHFFFAOYSA-L |
| XLogP | -1.26 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(2-iodopropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(2-iodopropanoate)?
The IUPAC name of calcium bis(2-iodopropanoate) (CID 88606274) is calcium bis(2-iodopropanoate).
What is the SMILES notation for calcium bis(2-iodopropanoate)?
The canonical SMILES for calcium bis(2-iodopropanoate) is CC(I)C(=O)[O-].CC(I)C(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(2-iodopropanoate)?
The InChIKey is ZKFDHVMOPYPGMX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H5IO2.Ca/c2*1-2(4)3(5)6;/h2*2H,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of calcium bis(2-iodopropanoate)?
calcium bis(2-iodopropanoate) has a molecular weight of 438.01 g/mol, XLogP of -1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(2-iodopropanoate) is sourced from PubChem (CID 88606274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).