About disilver;2-methylpropanedioate
disilver;2-methylpropanedioate (PubChem CID 121393244) has the molecular formula C4H4Ag2O4
and a molecular weight of 331.81 g/mol. Its IUPAC name is disilver;2-methylpropanedioate.
Molecular Properties
| Compound Name | disilver;2-methylpropanedioate |
| PubChem CID | 121393244 |
| Molecular Formula | C4H4Ag2O4 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 329.82 |
| IUPAC Name | disilver;2-methylpropanedioate |
| SMILES | CC(C(=O)[O-])C(=O)[O-].[Ag+].[Ag+] |
| InChI | InChI=1S/C4H6O4.2Ag/c1-2(3(5)6)4(7)8;;/h2H,1H3,(H,5,6)(H,7,8);;/q;2*+1/p-2 |
| InChIKey | BTKHXICOGOCPMM-UHFFFAOYSA-L |
| XLogP | -2.88 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze disilver;2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disilver;2-methylpropanedioate?
The IUPAC name of disilver;2-methylpropanedioate (CID 121393244) is disilver;2-methylpropanedioate.
What is the SMILES notation for disilver;2-methylpropanedioate?
The canonical SMILES for disilver;2-methylpropanedioate is CC(C(=O)[O-])C(=O)[O-].[Ag+].[Ag+].
What is the InChIKey of disilver;2-methylpropanedioate?
The InChIKey is BTKHXICOGOCPMM-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O4.2Ag/c1-2(3(5)6)4(7)8;;/h2H,1H3,(H,5,6)(H,7,8);;/q;2*+1/p-2.
What are the key properties of disilver;2-methylpropanedioate?
disilver;2-methylpropanedioate has a molecular weight of 331.81 g/mol, XLogP of -2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disilver;2-methylpropanedioate is sourced from PubChem (CID 121393244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).