About carbanylium;methane;2-methyl-3-oxobutanoate
carbanylium;methane;2-methyl-3-oxobutanoate (PubChem CID 157226748) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is carbanylium;methane;2-methyl-3-oxobutanoate.
Molecular Properties
| Compound Name | carbanylium;methane;2-methyl-3-oxobutanoate |
| PubChem CID | 157226748 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | carbanylium;methane;2-methyl-3-oxobutanoate |
| SMILES | C.CC(=O)C(C)C(=O)[O-].[CH3+] |
| InChI | InChI=1S/C5H8O3.CH4.CH3/c1-3(4(2)6)5(7)8;;/h3H,1-2H3,(H,7,8);1H4;1H3/q;;+1/p-1 |
| InChIKey | ATPXJAXNJUVECM-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;methane;2-methyl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;methane;2-methyl-3-oxobutanoate?
The IUPAC name of carbanylium;methane;2-methyl-3-oxobutanoate (CID 157226748) is carbanylium;methane;2-methyl-3-oxobutanoate.
What is the SMILES notation for carbanylium;methane;2-methyl-3-oxobutanoate?
The canonical SMILES for carbanylium;methane;2-methyl-3-oxobutanoate is C.CC(=O)C(C)C(=O)[O-].[CH3+].
What is the InChIKey of carbanylium;methane;2-methyl-3-oxobutanoate?
The InChIKey is ATPXJAXNJUVECM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3.CH4.CH3/c1-3(4(2)6)5(7)8;;/h3H,1-2H3,(H,7,8);1H4;1H3/q;;+1/p-1.
What are the key properties of carbanylium;methane;2-methyl-3-oxobutanoate?
carbanylium;methane;2-methyl-3-oxobutanoate has a molecular weight of 146.19 g/mol, XLogP of 0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;methane;2-methyl-3-oxobutanoate is sourced from PubChem (CID 157226748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).