About aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate)
aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) (PubChem CID 173021561) has the molecular formula C11H21AlO5
and a molecular weight of 260.27 g/mol. Its IUPAC name is aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate).
Molecular Properties
| Compound Name | aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) |
| PubChem CID | 173021561 |
| Molecular Formula | C11H21AlO5 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) |
| SMILES | CC(=O)C(C)C(=O)[O-].CCC[O-].CCC[O-].[Al+3] |
| InChI | InChI=1S/C5H8O3.2C3H7O.Al/c1-3(4(2)6)5(7)8;2*1-2-3-4;/h3H,1-2H3,(H,7,8);2*2-3H2,1H3;/q;2*-1;+3/p-1 |
| InChIKey | OLVJUKAZZSOEJS-UHFFFAOYSA-M |
| XLogP | -1.91 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate)?
The IUPAC name of aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) (CID 173021561) is aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate).
What is the SMILES notation for aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate)?
The canonical SMILES for aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) is CC(=O)C(C)C(=O)[O-].CCC[O-].CCC[O-].[Al+3].
What is the InChIKey of aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate)?
The InChIKey is OLVJUKAZZSOEJS-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3.2C3H7O.Al/c1-3(4(2)6)5(7)8;2*1-2-3-4;/h3H,1-2H3,(H,7,8);2*2-3H2,1H3;/q;2*-1;+3/p-1.
What are the key properties of aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate)?
aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) has a molecular weight of 260.27 g/mol, XLogP of -1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;2-methyl-3-oxobutanoate;bis(propan-1-olate) is sourced from PubChem (CID 173021561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).