About sodium 2-methyl-3-oxobutanoate
sodium 2-methyl-3-oxobutanoate (PubChem CID 23705742) has the molecular formula C5H7NaO3
and a molecular weight of 138.10 g/mol. Its IUPAC name is sodium 2-methyl-3-oxobutanoate.
Molecular Properties
| Compound Name | sodium 2-methyl-3-oxobutanoate |
| PubChem CID | 23705742 |
| Molecular Formula | C5H7NaO3 |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | sodium 2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H8O3.Na/c1-3(4(2)6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | AGCGGNCZCFZBNN-UHFFFAOYSA-M |
| XLogP | -4.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methyl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methyl-3-oxobutanoate?
The IUPAC name of sodium 2-methyl-3-oxobutanoate (CID 23705742) is sodium 2-methyl-3-oxobutanoate.
What is the SMILES notation for sodium 2-methyl-3-oxobutanoate?
The canonical SMILES for sodium 2-methyl-3-oxobutanoate is CC(=O)C(C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-methyl-3-oxobutanoate?
The InChIKey is AGCGGNCZCFZBNN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3.Na/c1-3(4(2)6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 2-methyl-3-oxobutanoate?
sodium 2-methyl-3-oxobutanoate has a molecular weight of 138.10 g/mol, XLogP of -4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methyl-3-oxobutanoate is sourced from PubChem (CID 23705742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).