sodium 2-methyl-3-oxobutanoate

C5H7NaO3 — CID 23705742

IUPACsodium 2-methyl-3-oxobutanoate
SMILESCC(=O)C(C)C(=O)[O-].[Na+]
InChIInChI=1S/C5H8O3.Na/c1-3(4(2)6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1
InChIKeyAGCGGNCZCFZBNN-UHFFFAOYSA-M
MW138.10 g/mol
LogP-4.03
Rot. Bonds2

About sodium 2-methyl-3-oxobutanoate

sodium 2-methyl-3-oxobutanoate (PubChem CID 23705742) has the molecular formula C5H7NaO3 and a molecular weight of 138.10 g/mol. Its IUPAC name is sodium 2-methyl-3-oxobutanoate.

Molecular Properties

Compound Namesodium 2-methyl-3-oxobutanoate
PubChem CID23705742
Molecular FormulaC5H7NaO3
Molecular Weight138.10 g/mol
Exact Mass138.03
IUPAC Namesodium 2-methyl-3-oxobutanoate
SMILESCC(=O)C(C)C(=O)[O-].[Na+]
InChIInChI=1S/C5H8O3.Na/c1-3(4(2)6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1
InChIKeyAGCGGNCZCFZBNN-UHFFFAOYSA-M
XLogP-4.03
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.10
LogP ≤ 5-4.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze sodium 2-methyl-3-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-methyl-3-oxobutanoate?
The IUPAC name of sodium 2-methyl-3-oxobutanoate (CID 23705742) is sodium 2-methyl-3-oxobutanoate.
What is the SMILES notation for sodium 2-methyl-3-oxobutanoate?
The canonical SMILES for sodium 2-methyl-3-oxobutanoate is CC(=O)C(C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-methyl-3-oxobutanoate?
The InChIKey is AGCGGNCZCFZBNN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3.Na/c1-3(4(2)6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 2-methyl-3-oxobutanoate?
sodium 2-methyl-3-oxobutanoate has a molecular weight of 138.10 g/mol, XLogP of -4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methyl-3-oxobutanoate is sourced from PubChem (CID 23705742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).