About methane;2-sulfanylpropanoate
methane;2-sulfanylpropanoate (PubChem CID 158507448) has the molecular formula C4H9O2S-
and a molecular weight of 121.18 g/mol. Its IUPAC name is methane;2-sulfanylpropanoate.
Molecular Properties
| Compound Name | methane;2-sulfanylpropanoate |
| PubChem CID | 158507448 |
| Molecular Formula | C4H9O2S- |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | methane;2-sulfanylpropanoate |
| SMILES | C.CC(S)C(=O)[O-] |
| InChI | InChI=1S/C3H6O2S.CH4/c1-2(6)3(4)5;/h2,6H,1H3,(H,4,5);1H4/p-1 |
| InChIKey | HKQALSTXBFDMPP-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methane;2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-sulfanylpropanoate?
The IUPAC name of methane;2-sulfanylpropanoate (CID 158507448) is methane;2-sulfanylpropanoate.
What is the SMILES notation for methane;2-sulfanylpropanoate?
The canonical SMILES for methane;2-sulfanylpropanoate is C.CC(S)C(=O)[O-].
What is the InChIKey of methane;2-sulfanylpropanoate?
The InChIKey is HKQALSTXBFDMPP-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2S.CH4/c1-2(6)3(4)5;/h2,6H,1H3,(H,4,5);1H4/p-1.
What are the key properties of methane;2-sulfanylpropanoate?
methane;2-sulfanylpropanoate has a molecular weight of 121.18 g/mol, XLogP of -0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-sulfanylpropanoate is sourced from PubChem (CID 158507448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).