C6H8O4-2 — CID 6950213
(2R,3R)-2,3-dimethylbutanedioate (PubChem CID 6950213) has the molecular formula C6H8O4-2 and a molecular weight of 144.13 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethylbutanedioate.
| Compound Name | (2R,3R)-2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 6950213 |
| Molecular Formula | C6H8O4-2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (2R,3R)-2,3-dimethylbutanedioate |
| SMILES | CC(C(=O)[O-])[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C6H10O4/c1-3(5(7)8)4(2)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2/t3-,4?/m1/s1 |
| InChIKey | KLZYRCVPDWTZLH-SYPWQXSBSA-L |
| XLogP | -2.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |