C4H11NO4 — CID 164518262
azanium 3,3-dihydroxy-2-methylpropanoate (PubChem CID 164518262) has the molecular formula C4H11NO4 and a molecular weight of 137.13 g/mol. Its IUPAC name is azanium 3,3-dihydroxy-2-methylpropanoate.
| Compound Name | azanium 3,3-dihydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 164518262 |
| Molecular Formula | C4H11NO4 |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | azanium 3,3-dihydroxy-2-methylpropanoate |
| SMILES | CC(C(=O)[O-])C(O)O.[NH4+] |
| InChI | InChI=1S/C4H8O4.H3N/c1-2(3(5)6)4(7)8;/h2-3,5-6H,1H3,(H,7,8);1H3 |
| InChIKey | DZYITRLRURCKEX-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|