C6H16N2O4 — CID 162318469
diazanium;2,3-dimethylbutanedioate (PubChem CID 162318469) has the molecular formula C6H16N2O4 and a molecular weight of 180.20 g/mol. Its IUPAC name is diazanium;2,3-dimethylbutanedioate.
| Compound Name | diazanium;2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 162318469 |
| Molecular Formula | C6H16N2O4 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | diazanium;2,3-dimethylbutanedioate |
| SMILES | CC(C(=O)[O-])C(C)C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C6H10O4.2H3N/c1-3(5(7)8)4(2)6(9)10;;/h3-4H,1-2H3,(H,7,8)(H,9,10);2*1H3 |
| InChIKey | GAEYIGLOEUDHEZ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |