C4H7KO4 — CID 175445001
potassium 3,3-dihydroxy-2-methylpropanoate (PubChem CID 175445001) has the molecular formula C4H7KO4 and a molecular weight of 158.19 g/mol. Its IUPAC name is potassium 3,3-dihydroxy-2-methylpropanoate.
| Compound Name | potassium 3,3-dihydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 175445001 |
| Molecular Formula | C4H7KO4 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | potassium 3,3-dihydroxy-2-methylpropanoate |
| SMILES | CC(C(=O)[O-])C(O)O.[K+] |
| InChI | InChI=1S/C4H8O4.K/c1-2(3(5)6)4(7)8;/h2-3,5-6H,1H3,(H,7,8);/q;+1/p-1 |
| InChIKey | WLBYHGPRBGONSN-UHFFFAOYSA-M |
| XLogP | -5.31 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|