C5H9O3- — CID 18654775
(2S,3R)-3-hydroxy-2-methylbutanoate (PubChem CID 18654775) has the molecular formula C5H9O3- and a molecular weight of 117.12 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-methylbutanoate.
| Compound Name | (2S,3R)-3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 18654775 |
| Molecular Formula | C5H9O3- |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-methylbutanoate |
| SMILES | CC(C(=O)[O-])[C@@H](C)O |
| InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/p-1/t3?,4-/m1/s1 |
| InChIKey | VEXDRERIMPLZLU-SRBOSORUSA-M |
| XLogP | -1.25 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |