C4H4O4S2-2 — CID 11865476
(2S,3R)-2,3-bis(sulfanyl)butanedioate (PubChem CID 11865476) has the molecular formula C4H4O4S2-2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(sulfanyl)butanedioate.
| Compound Name | (2S,3R)-2,3-bis(sulfanyl)butanedioate |
|---|---|
| PubChem CID | 11865476 |
| Molecular Formula | C4H4O4S2-2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | (2S,3R)-2,3-bis(sulfanyl)butanedioate |
| SMILES | O=C([O-])[C@@H](S)[C@@H](S)C(=O)[O-] |
| InChI | InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/p-2/t1-,2+ |
| InChIKey | ACTRVOBWPAIOHC-XIXRPRMCSA-L |
| XLogP | -2.92 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|