About zinc 2-hydroxypropanedioate
zinc 2-hydroxypropanedioate (PubChem CID 20549630) has the molecular formula C3H2O5Zn
and a molecular weight of 183.43 g/mol. Its IUPAC name is zinc 2-hydroxypropanedioate.
Molecular Properties
| Compound Name | zinc 2-hydroxypropanedioate |
| PubChem CID | 20549630 |
| Molecular Formula | C3H2O5Zn |
| Molecular Weight | 183.43 g/mol |
| Exact Mass | 181.92 |
| IUPAC Name | zinc 2-hydroxypropanedioate |
| SMILES | O=C([O-])C(O)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C3H4O5.Zn/c4-1(2(5)6)3(7)8;/h1,4H,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | VKFOBSSYOGGCDS-UHFFFAOYSA-L |
| XLogP | -4.16 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.43 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc 2-hydroxypropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 2-hydroxypropanedioate?
The IUPAC name of zinc 2-hydroxypropanedioate (CID 20549630) is zinc 2-hydroxypropanedioate.
What is the SMILES notation for zinc 2-hydroxypropanedioate?
The canonical SMILES for zinc 2-hydroxypropanedioate is O=C([O-])C(O)C(=O)[O-].[Zn+2].
What is the InChIKey of zinc 2-hydroxypropanedioate?
The InChIKey is VKFOBSSYOGGCDS-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O5.Zn/c4-1(2(5)6)3(7)8;/h1,4H,(H,5,6)(H,7,8);/q;+2/p-2.
What are the key properties of zinc 2-hydroxypropanedioate?
zinc 2-hydroxypropanedioate has a molecular weight of 183.43 g/mol, XLogP of -4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 2-hydroxypropanedioate is sourced from PubChem (CID 20549630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).