About CID 139243453
CID 139243453 (PubChem CID 139243453) has the molecular formula C3H4O3-
and a molecular weight of 88.06 g/mol.
Molecular Properties
| Compound Name | CID 139243453 |
| PubChem CID | 139243453 |
| Molecular Formula | C3H4O3- |
| Molecular Weight | 88.06 g/mol |
| Exact Mass | 88.02 |
| IUPAC Name | — |
| SMILES | [CH2]C(O)C(=O)[O-] |
| InChI | InChI=1S/C3H5O3/c1-2(4)3(5)6/h2,4H,1H2,(H,5,6)/p-1 |
| InChIKey | OGZCUQXOOQQARZ-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.06 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 139243453 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139243453?
The IUPAC name of CID 139243453 (CID 139243453) is not available.
What is the SMILES notation for CID 139243453?
The canonical SMILES for CID 139243453 is [CH2]C(O)C(=O)[O-].
What is the InChIKey of CID 139243453?
The InChIKey is OGZCUQXOOQQARZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5O3/c1-2(4)3(5)6/h2,4H,1H2,(H,5,6)/p-1.
What are the key properties of CID 139243453?
CID 139243453 has a molecular weight of 88.06 g/mol, XLogP of -2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139243453 is sourced from PubChem (CID 139243453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).