About sodium 2-ethenylbut-3-enoate
sodium 2-ethenylbut-3-enoate (PubChem CID 23676567) has the molecular formula C6H7NaO2
and a molecular weight of 134.11 g/mol. Its IUPAC name is sodium 2-ethenylbut-3-enoate.
Molecular Properties
| Compound Name | sodium 2-ethenylbut-3-enoate |
| PubChem CID | 23676567 |
| Molecular Formula | C6H7NaO2 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | sodium 2-ethenylbut-3-enoate |
| SMILES | C=CC(C=C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H8O2.Na/c1-3-5(4-2)6(7)8;/h3-5H,1-2H2,(H,7,8);/q;+1/p-1 |
| InChIKey | CCHUQBSAFDQGAS-UHFFFAOYSA-M |
| XLogP | -3.27 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-ethenylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-ethenylbut-3-enoate?
The IUPAC name of sodium 2-ethenylbut-3-enoate (CID 23676567) is sodium 2-ethenylbut-3-enoate.
What is the SMILES notation for sodium 2-ethenylbut-3-enoate?
The canonical SMILES for sodium 2-ethenylbut-3-enoate is C=CC(C=C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-ethenylbut-3-enoate?
The InChIKey is CCHUQBSAFDQGAS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O2.Na/c1-3-5(4-2)6(7)8;/h3-5H,1-2H2,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 2-ethenylbut-3-enoate?
sodium 2-ethenylbut-3-enoate has a molecular weight of 134.11 g/mol, XLogP of -3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethenylbut-3-enoate is sourced from PubChem (CID 23676567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).