C7H11NaO4 — CID 23710764
sodium 3,5-dihydroxyhept-6-enoate (PubChem CID 23710764) has the molecular formula C7H11NaO4 and a molecular weight of 182.15 g/mol. Its IUPAC name is sodium 3,5-dihydroxyhept-6-enoate.
| Compound Name | sodium 3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 23710764 |
| Molecular Formula | C7H11NaO4 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | sodium 3,5-dihydroxyhept-6-enoate |
| SMILES | C=CC(O)CC(O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H12O4.Na/c1-2-5(8)3-6(9)4-7(10)11;/h2,5-6,8-9H,1,3-4H2,(H,10,11);/q;+1/p-1 |
| InChIKey | OSRPNTNABHQMOT-UHFFFAOYSA-M |
| XLogP | -4.57 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|