C7H10O2 — CID 157461743
5-hydroxyhepta-1,6-dien-3-one (PubChem CID 157461743) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 5-hydroxyhepta-1,6-dien-3-one.
| Compound Name | 5-hydroxyhepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 157461743 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 5-hydroxyhepta-1,6-dien-3-one |
| SMILES | C=CC(=O)CC(O)C=C |
| InChI | InChI=1S/C7H10O2/c1-3-6(8)5-7(9)4-2/h3-4,6,8H,1-2,5H2 |
| InChIKey | BTZWCWJPXHMGHZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|