C6H7Cl3O2 — CID 131230041
(5R)-6,6,6-trichloro-5-hydroxyhex-1-en-3-one (PubChem CID 131230041) has the molecular formula C6H7Cl3O2 and a molecular weight of 217.48 g/mol. Its IUPAC name is (5R)-6,6,6-trichloro-5-hydroxyhex-1-en-3-one.
| Compound Name | (5R)-6,6,6-trichloro-5-hydroxyhex-1-en-3-one |
|---|---|
| PubChem CID | 131230041 |
| Molecular Formula | C6H7Cl3O2 |
| Molecular Weight | 217.48 g/mol |
| Exact Mass | 215.95 |
| IUPAC Name | (5R)-6,6,6-trichloro-5-hydroxyhex-1-en-3-one |
| SMILES | C=CC(=O)C[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H7Cl3O2/c1-2-4(10)3-5(11)6(7,8)9/h2,5,11H,1,3H2/t5-/m1/s1 |
| InChIKey | KISXXHRPGHLFAA-RXMQYKEDSA-N |
| XLogP | 1.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|