C8H13Cl3O3 — CID 71354312
acetic acid;(2R)-1,1,1-trichloro-4-methylpent-4-en-2-ol (PubChem CID 71354312) has the molecular formula C8H13Cl3O3 and a molecular weight of 263.55 g/mol. Its IUPAC name is acetic acid;(2R)-1,1,1-trichloro-4-methylpent-4-en-2-ol.
| Compound Name | acetic acid;(2R)-1,1,1-trichloro-4-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 71354312 |
| Molecular Formula | C8H13Cl3O3 |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | acetic acid;(2R)-1,1,1-trichloro-4-methylpent-4-en-2-ol |
| SMILES | C=C(C)C[C@@H](O)C(Cl)(Cl)Cl.CC(=O)O |
| InChI | InChI=1S/C6H9Cl3O.C2H4O2/c1-4(2)3-5(10)6(7,8)9;1-2(3)4/h5,10H,1,3H2,2H3;1H3,(H,3,4)/t5-;/m1./s1 |
| InChIKey | LXCZTWLUWCHKLG-NUBCRITNSA-N |
| XLogP | 2.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|