C8H14Cl6O2 — CID 173372937
acetic acid;bis(1,1,1-trichloropropane) (PubChem CID 173372937) has the molecular formula C8H14Cl6O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is acetic acid;bis(1,1,1-trichloropropane).
| Compound Name | acetic acid;bis(1,1,1-trichloropropane) |
|---|---|
| PubChem CID | 173372937 |
| Molecular Formula | C8H14Cl6O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | acetic acid;bis(1,1,1-trichloropropane) |
| SMILES | CC(=O)O.CCC(Cl)(Cl)Cl.CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/2C3H5Cl3.C2H4O2/c2*1-2-3(4,5)6;1-2(3)4/h2*2H2,1H3;1H3,(H,3,4) |
| InChIKey | BBLNJQARBXYAIG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|