C5H8Cl4O — CID 19428789
propan-2-one;1,1,1,2-tetrachloroethane (PubChem CID 19428789) has the molecular formula C5H8Cl4O and a molecular weight of 225.93 g/mol. Its IUPAC name is propan-2-one;1,1,1,2-tetrachloroethane.
| Compound Name | propan-2-one;1,1,1,2-tetrachloroethane |
|---|---|
| PubChem CID | 19428789 |
| Molecular Formula | C5H8Cl4O |
| Molecular Weight | 225.93 g/mol |
| Exact Mass | 223.93 |
| IUPAC Name | propan-2-one;1,1,1,2-tetrachloroethane |
| SMILES | CC(C)=O.ClCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H6O.C2H2Cl4/c1-3(2)4;3-1-2(4,5)6/h1-2H3;1H2 |
| InChIKey | MBXKDNSDWFQKOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|