C5H9Cl3OSn — CID 171039325
λ2-stannane;5,5,5-trichloropentan-2-one (PubChem CID 171039325) has the molecular formula C5H9Cl3OSn and a molecular weight of 310.20 g/mol. Its IUPAC name is λ2-stannane;5,5,5-trichloropentan-2-one.
| Compound Name | λ2-stannane;5,5,5-trichloropentan-2-one |
|---|---|
| PubChem CID | 171039325 |
| Molecular Formula | C5H9Cl3OSn |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.87 |
| IUPAC Name | λ2-stannane;5,5,5-trichloropentan-2-one |
| SMILES | CC(=O)CCC(Cl)(Cl)Cl.[SnH2] |
| InChI | InChI=1S/C5H7Cl3O.Sn.2H/c1-4(9)2-3-5(6,7)8;;;/h2-3H2,1H3;;; |
| InChIKey | QRFGLCRQKAWHQK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|