C8H8Cl6MgO4 — CID 140531425
magnesium bis(4,4,4-trichlorobutanoate) (PubChem CID 140531425) has the molecular formula C8H8Cl6MgO4 and a molecular weight of 405.17 g/mol. Its IUPAC name is magnesium bis(4,4,4-trichlorobutanoate).
| Compound Name | magnesium bis(4,4,4-trichlorobutanoate) |
|---|---|
| PubChem CID | 140531425 |
| Molecular Formula | C8H8Cl6MgO4 |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 401.84 |
| IUPAC Name | magnesium bis(4,4,4-trichlorobutanoate) |
| SMILES | O=C([O-])CCC(Cl)(Cl)Cl.O=C([O-])CCC(Cl)(Cl)Cl.[Mg+2] |
| InChI | InChI=1S/2C4H5Cl3O2.Mg/c2*5-4(6,7)2-1-3(8)9;/h2*1-2H2,(H,8,9);/q;;+2/p-2 |
| InChIKey | AJMRGAUVLMRFAF-UHFFFAOYSA-L |
| XLogP | 1.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|