About acetic acid;chloro(trifluoro)methane
acetic acid;chloro(trifluoro)methane (PubChem CID 88651424) has the molecular formula C3H4ClF3O2
and a molecular weight of 164.51 g/mol. Its IUPAC name is acetic acid;chloro(trifluoro)methane.
Molecular Properties
| Compound Name | acetic acid;chloro(trifluoro)methane |
| PubChem CID | 88651424 |
| Molecular Formula | C3H4ClF3O2 |
| Molecular Weight | 164.51 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | acetic acid;chloro(trifluoro)methane |
| SMILES | CC(=O)O.FC(F)(F)Cl |
| InChI | InChI=1S/C2H4O2.CClF3/c1-2(3)4;2-1(3,4)5/h1H3,(H,3,4); |
| InChIKey | UYXWCAZGHAXASI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;chloro(trifluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;chloro(trifluoro)methane?
The IUPAC name of acetic acid;chloro(trifluoro)methane (CID 88651424) is acetic acid;chloro(trifluoro)methane.
What is the SMILES notation for acetic acid;chloro(trifluoro)methane?
The canonical SMILES for acetic acid;chloro(trifluoro)methane is CC(=O)O.FC(F)(F)Cl.
What is the InChIKey of acetic acid;chloro(trifluoro)methane?
The InChIKey is UYXWCAZGHAXASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.CClF3/c1-2(3)4;2-1(3,4)5/h1H3,(H,3,4);.
What are the key properties of acetic acid;chloro(trifluoro)methane?
acetic acid;chloro(trifluoro)methane has a molecular weight of 164.51 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;chloro(trifluoro)methane is sourced from PubChem (CID 88651424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).