C8H11Cl3O2 — CID 15607263
[(2R)-1,1,1-trichloro-4-methylpent-4-en-2-yl] acetate (PubChem CID 15607263) has the molecular formula C8H11Cl3O2 and a molecular weight of 245.53 g/mol. Its IUPAC name is [(2R)-1,1,1-trichloro-4-methylpent-4-en-2-yl] acetate.
| Compound Name | [(2R)-1,1,1-trichloro-4-methylpent-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 15607263 |
| Molecular Formula | C8H11Cl3O2 |
| Molecular Weight | 245.53 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | [(2R)-1,1,1-trichloro-4-methylpent-4-en-2-yl] acetate |
| SMILES | C=C(C)C[C@@H](OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H11Cl3O2/c1-5(2)4-7(8(9,10)11)13-6(3)12/h7H,1,4H2,2-3H3/t7-/m1/s1 |
| InChIKey | ZFIHZJPVRVOBFF-SSDOTTSWSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|