C19H33Cl3O5Si — CID 134941175
ethyl (Z)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoate (PubChem CID 134941175) has the molecular formula C19H33Cl3O5Si and a molecular weight of 475.91 g/mol. Its IUPAC name is ethyl (Z)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoate.
| Compound Name | ethyl (Z)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoate |
|---|---|
| PubChem CID | 134941175 |
| Molecular Formula | C19H33Cl3O5Si |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | ethyl (Z)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoate |
| SMILES | CCOC(=O)CC(O[Si](C)(C)C(C)(C)C)/C(C)=C\CC(OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H33Cl3O5Si/c1-9-25-17(24)12-15(27-28(7,8)18(4,5)6)13(2)10-11-16(19(20,21)22)26-14(3)23/h10,15-16H,9,11-12H2,1-8H3/b13-10- |
| InChIKey | UCOBGBWAOODAMK-RAXLEYEMSA-N |
| XLogP | 5.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|