C17H34O4Si — CID 134952080
ethyl (Z,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,6-dimethylhept-5-enoate (PubChem CID 134952080) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is ethyl (Z,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,6-dimethylhept-5-enoate.
| Compound Name | ethyl (Z,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,6-dimethylhept-5-enoate |
|---|---|
| PubChem CID | 134952080 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ethyl (Z,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,6-dimethylhept-5-enoate |
| SMILES | CCOC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(/C)CO |
| InChI | InChI=1S/C17H34O4Si/c1-9-20-16(19)11-15(14(3)10-13(2)12-18)21-22(7,8)17(4,5)6/h10,14-15,18H,9,11-12H2,1-8H3/b13-10-/t14-,15-/m1/s1 |
| InChIKey | JUIMEWBPAGLMGQ-TZNPFNDMSA-N |
| XLogP | 3.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|