C37H65NO6Si — CID 53342207
[(2E,4R,5R,7E,9E,13S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-13-carbamoyloxy-1-hydroxy-2,4,7-trimethylhexadeca-2,7,9,15-tetraen-5-yl] undec-10-enoate (PubChem CID 53342207) has the molecular formula C37H65NO6Si and a molecular weight of 648.01 g/mol. Its IUPAC name is [(2E,4R,5R,7E,9E,13S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-13-carbamoyloxy-1-hydroxy-2,4,7-trimethylhexadeca-2,7,9,15-tetraen-5-yl] undec-10-enoate.
| Compound Name | [(2E,4R,5R,7E,9E,13S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-13-carbamoyloxy-1-hydroxy-2,4,7-trimethylhexadeca-2,7,9,15-tetraen-5-yl] undec-10-enoate |
|---|---|
| PubChem CID | 53342207 |
| Molecular Formula | C37H65NO6Si |
| Molecular Weight | 648.01 g/mol |
| Exact Mass | 647.46 |
| IUPAC Name | [(2E,4R,5R,7E,9E,13S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-13-carbamoyloxy-1-hydroxy-2,4,7-trimethylhexadeca-2,7,9,15-tetraen-5-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)O[C@H](C/C(C)=C/C=C/CC[C@H](OC(N)=O)[C@H](C=C)O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)CO |
| InChI | InChI=1S/C37H65NO6Si/c1-11-13-14-15-16-17-18-22-25-35(40)42-34(31(5)26-30(4)28-39)27-29(3)23-20-19-21-24-33(43-36(38)41)32(12-2)44-45(9,10)37(6,7)8/h11-12,19-20,23,26,31-34,39H,1-2,13-18,21-22,24-25,27-28H2,3-10H3,(H2,38,41)/b20-19+,29-23+,30-26+/t31-,32+,33+,34-/m1/s1 |
| InChIKey | ZEXXWFRNWRTFMI-HMBSVSJHSA-N |
| XLogP | 9.49 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.01 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|