About [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate
[tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate (PubChem CID 91743170) has the molecular formula C24H48O2Si
and a molecular weight of 396.73 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate |
| PubChem CID | 91743170 |
| Molecular Formula | C24H48O2Si |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)26-27(5,6)24(2,3)4/h12-13H,7-11,14-22H2,1-6H3/b13-12+ |
| InChIKey | ZYXNQUCAMMMNNE-OUKQBFOZSA-N |
| XLogP | 8.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate (CID 91743170) is [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate is CCCCCC/C=C/CCCCCCCCCC(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate?
The InChIKey is ZYXNQUCAMMMNNE-OUKQBFOZSA-N. The full InChI is InChI=1S/C24H48O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)26-27(5,6)24(2,3)4/h12-13H,7-11,14-22H2,1-6H3/b13-12+.
What are the key properties of [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate?
[tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate has a molecular weight of 396.73 g/mol, XLogP of 8.57, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] (E)-octadec-11-enoate is sourced from PubChem (CID 91743170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).