C29H56O5Si — CID 45101778
[(2R)-3-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 45101778) has the molecular formula C29H56O5Si and a molecular weight of 512.85 g/mol. Its IUPAC name is [(2R)-3-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-3-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 45101778 |
| Molecular Formula | C29H56O5Si |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | [(2R)-3-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](COC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H56O5Si/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28(31)33-25-27(24-32-26(2)30)34-35(6,7)29(3,4)5/h15-16,27H,8-14,17-25H2,1-7H3/b16-15-/t27-/m1/s1 |
| InChIKey | WAOCLBNFGIRTMG-KRQKXCKJSA-N |
| XLogP | 8.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|