C24H45NO3Si — CID 101333763
N-[(2E,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide (PubChem CID 101333763) has the molecular formula C24H45NO3Si and a molecular weight of 423.71 g/mol. Its IUPAC name is N-[(2E,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide.
| Compound Name | N-[(2E,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide |
|---|---|
| PubChem CID | 101333763 |
| Molecular Formula | C24H45NO3Si |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | N-[(2E,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide |
| SMILES | C=CCCCCC(=O)NC/C(C)=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC |
| InChI | InChI=1S/C24H45NO3Si/c1-11-13-14-15-16-22(26)25-18-19(3)17-20(4)23(21(12-2)27-8)28-29(9,10)24(5,6)7/h11-12,17,20-21,23H,1-2,13-16,18H2,3-10H3,(H,25,26)/b19-17+/t20-,21+,23+/m1/s1 |
| InChIKey | ZYUZVKLTAARIBU-UTHNZSCYSA-N |
| XLogP | 6.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|