C27H54O4Si2 — CID 57386727
(2S,3S,4R,5R,6E,9R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,4,7-trimethylundeca-6,10-dienal (PubChem CID 57386727) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is (2S,3S,4R,5R,6E,9R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,4,7-trimethylundeca-6,10-dienal.
| Compound Name | (2S,3S,4R,5R,6E,9R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,4,7-trimethylundeca-6,10-dienal |
|---|---|
| PubChem CID | 57386727 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | (2S,3S,4R,5R,6E,9R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,4,7-trimethylundeca-6,10-dienal |
| SMILES | C=C[C@@H](C/C(C)=C/[C@@H](OC)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O4Si2/c1-16-23(30-32(12,13)26(5,6)7)17-20(2)18-24(29-11)22(4)25(21(3)19-28)31-33(14,15)27(8,9)10/h16,18-19,21-25H,1,17H2,2-15H3/b20-18+/t21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | AIBYNMQTJNFDTE-FYSJQWPNSA-N |
| XLogP | 7.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|