C25H42O4Si — CID 11189745
tert-butyl-[(2S,3R,4E,7R)-3-methoxy-7-(4-methoxyphenoxy)-2,5-dimethylnona-4,8-dienoxy]-dimethylsilane (PubChem CID 11189745) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4E,7R)-3-methoxy-7-(4-methoxyphenoxy)-2,5-dimethylnona-4,8-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4E,7R)-3-methoxy-7-(4-methoxyphenoxy)-2,5-dimethylnona-4,8-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11189745 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | tert-butyl-[(2S,3R,4E,7R)-3-methoxy-7-(4-methoxyphenoxy)-2,5-dimethylnona-4,8-dienoxy]-dimethylsilane |
| SMILES | C=C[C@@H](C/C(C)=C/[C@@H](OC)[C@@H](C)CO[Si](C)(C)C(C)(C)C)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H42O4Si/c1-11-21(29-23-14-12-22(26-7)13-15-23)16-19(2)17-24(27-8)20(3)18-28-30(9,10)25(4,5)6/h11-15,17,20-21,24H,1,16,18H2,2-10H3/b19-17+/t20-,21-,24+/m0/s1 |
| InChIKey | BNEWLAWTXFFBGU-JPTPODOHSA-N |
| XLogP | 6.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|